C13H20Cl2N2 — CID 50944348
1-(2,3-dihydro-1H-inden-2-yl)piperazine;dihydrochloride (PubChem CID 50944348) has the molecular formula C13H20Cl2N2 and a molecular weight of 275.22 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)piperazine;dihydrochloride.
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)piperazine;dihydrochloride |
|---|---|
| PubChem CID | 50944348 |
| Molecular Formula | C13H20Cl2N2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)piperazine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2c(c1)CC(N1CCNCC1)C2 |
| InChI | InChI=1S/C13H18N2.2ClH/c1-2-4-12-10-13(9-11(12)3-1)15-7-5-14-6-8-15;;/h1-4,13-14H,5-10H2;2*1H |
| InChIKey | CHXVIAWGVGKXPO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |