About 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine
3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine (PubChem CID 107854036) has the molecular formula C19H28N2
and a molecular weight of 284.45 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine.
Molecular Properties
| Compound Name | 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine |
| PubChem CID | 107854036 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine |
| SMILES | c1ccc2c(c1)CC(N1CCNC(C3CCCCC3)C1)C2 |
| InChI | InChI=1S/C19H28N2/c1-2-6-15(7-3-1)19-14-21(11-10-20-19)18-12-16-8-4-5-9-17(16)13-18/h4-5,8-9,15,18-20H,1-3,6-7,10-14H2 |
| InChIKey | AOXYXIMWGRYEHV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine?
The IUPAC name of 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine (CID 107854036) is 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine.
What is the SMILES notation for 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine?
The canonical SMILES for 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine is c1ccc2c(c1)CC(N1CCNC(C3CCCCC3)C1)C2.
What is the InChIKey of 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine?
The InChIKey is AOXYXIMWGRYEHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2/c1-2-6-15(7-3-1)19-14-21(11-10-20-19)18-12-16-8-4-5-9-17(16)13-18/h4-5,8-9,15,18-20H,1-3,6-7,10-14H2.
What are the key properties of 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine?
3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine has a molecular weight of 284.45 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1-(2,3-dihydro-1H-inden-2-yl)piperazine is sourced from PubChem (CID 107854036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).