C18H34N2 — CID 64945306
1-cycloheptyl-3-cyclohexyl-1,4-diazepane (PubChem CID 64945306) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 1-cycloheptyl-3-cyclohexyl-1,4-diazepane.
| Compound Name | 1-cycloheptyl-3-cyclohexyl-1,4-diazepane |
|---|---|
| PubChem CID | 64945306 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 1-cycloheptyl-3-cyclohexyl-1,4-diazepane |
| SMILES | C1CCC(C2CN(C3CCCCCC3)CCCN2)CC1 |
| InChI | InChI=1S/C18H34N2/c1-2-7-12-17(11-6-1)20-14-8-13-19-18(15-20)16-9-4-3-5-10-16/h16-19H,1-15H2 |
| InChIKey | NJSHSBLZFDZREH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |