C15H28N2 — CID 82931358
6-cycloheptyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine (PubChem CID 82931358) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 6-cycloheptyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine.
| Compound Name | 6-cycloheptyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine |
|---|---|
| PubChem CID | 82931358 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 6-cycloheptyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine |
| SMILES | C1CCCC(N2CCC3NCCCC3C2)CC1 |
| InChI | InChI=1S/C15H28N2/c1-2-4-8-14(7-3-1)17-11-9-15-13(12-17)6-5-10-16-15/h13-16H,1-12H2 |
| InChIKey | DZHFMWWRRIDJSF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |