C19H37N3 — CID 68721313
1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;1-cyclohexyldiazinane (PubChem CID 68721313) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;1-cyclohexyldiazinane.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;1-cyclohexyldiazinane |
|---|---|
| PubChem CID | 68721313 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;1-cyclohexyldiazinane |
| SMILES | C1CCC(N2CCCCN2)CC1.C1CCC2NCCCC2C1 |
| InChI | InChI=1S/C10H20N2.C9H17N/c1-2-6-10(7-3-1)12-9-5-4-8-11-12;1-2-6-9-8(4-1)5-3-7-10-9/h10-11H,1-9H2;8-10H,1-7H2 |
| InChIKey | RQIQTGJVQUUTDR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |