About 2-cycloheptylpiperidine;hydrochloride
2-cycloheptylpiperidine;hydrochloride (PubChem CID 115030388) has the molecular formula C12H24ClN
and a molecular weight of 217.78 g/mol. Its IUPAC name is 2-cycloheptylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 2-cycloheptylpiperidine;hydrochloride |
| PubChem CID | 115030388 |
| Molecular Formula | C12H24ClN |
| Molecular Weight | 217.78 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-cycloheptylpiperidine;hydrochloride |
| SMILES | C1CCCC(C2CCCCN2)CC1.Cl |
| InChI | InChI=1S/C12H23N.ClH/c1-2-4-8-11(7-3-1)12-9-5-6-10-13-12;/h11-13H,1-10H2;1H |
| InChIKey | UQXYHCCFFSKKPT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.78 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cycloheptylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptylpiperidine;hydrochloride?
The IUPAC name of 2-cycloheptylpiperidine;hydrochloride (CID 115030388) is 2-cycloheptylpiperidine;hydrochloride.
What is the SMILES notation for 2-cycloheptylpiperidine;hydrochloride?
The canonical SMILES for 2-cycloheptylpiperidine;hydrochloride is C1CCCC(C2CCCCN2)CC1.Cl.
What is the InChIKey of 2-cycloheptylpiperidine;hydrochloride?
The InChIKey is UQXYHCCFFSKKPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.ClH/c1-2-4-8-11(7-3-1)12-9-5-6-10-13-12;/h11-13H,1-10H2;1H.
What are the key properties of 2-cycloheptylpiperidine;hydrochloride?
2-cycloheptylpiperidine;hydrochloride has a molecular weight of 217.78 g/mol, XLogP of 3.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptylpiperidine;hydrochloride is sourced from PubChem (CID 115030388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).