About 2-cyclopentylpyrrolidine
2-cyclopentylpyrrolidine (PubChem CID 4031549) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 2-cyclopentylpyrrolidine.
Molecular Properties
| Compound Name | 2-cyclopentylpyrrolidine |
| PubChem CID | 4031549 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 2-cyclopentylpyrrolidine |
| SMILES | C1CCC(C2CCCN2)C1 |
| InChI | InChI=1S/C9H17N/c1-2-5-8(4-1)9-6-3-7-10-9/h8-10H,1-7H2 |
| InChIKey | WXQFEZGWHIDPIP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopentylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylpyrrolidine?
The IUPAC name of 2-cyclopentylpyrrolidine (CID 4031549) is 2-cyclopentylpyrrolidine.
What is the SMILES notation for 2-cyclopentylpyrrolidine?
The canonical SMILES for 2-cyclopentylpyrrolidine is C1CCC(C2CCCN2)C1.
What is the InChIKey of 2-cyclopentylpyrrolidine?
The InChIKey is WXQFEZGWHIDPIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-2-5-8(4-1)9-6-3-7-10-9/h8-10H,1-7H2.
What are the key properties of 2-cyclopentylpyrrolidine?
2-cyclopentylpyrrolidine has a molecular weight of 139.24 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylpyrrolidine is sourced from PubChem (CID 4031549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).