C12H12N2 — CID 82163959
2-cyclopropyl-1,3-dihydroisoindole-5-carbonitrile (PubChem CID 82163959) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-cyclopropyl-1,3-dihydroisoindole-5-carbonitrile.
| Compound Name | 2-cyclopropyl-1,3-dihydroisoindole-5-carbonitrile |
|---|---|
| PubChem CID | 82163959 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-cyclopropyl-1,3-dihydroisoindole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CN(C1CC1)C2 |
| InChI | InChI=1S/C12H12N2/c13-6-9-1-2-10-7-14(12-3-4-12)8-11(10)5-9/h1-2,5,12H,3-4,7-8H2 |
| InChIKey | NSSPDFSCHPQWRP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |