C11H11N2- — CID 58778089
2-methanidyl-3,4-dihydro-1H-isoquinoline-6-carbonitrile (PubChem CID 58778089) has the molecular formula C11H11N2- and a molecular weight of 171.22 g/mol. Its IUPAC name is 2-methanidyl-3,4-dihydro-1H-isoquinoline-6-carbonitrile.
| Compound Name | 2-methanidyl-3,4-dihydro-1H-isoquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 58778089 |
| Molecular Formula | C11H11N2- |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 2-methanidyl-3,4-dihydro-1H-isoquinoline-6-carbonitrile |
| SMILES | [CH2-]N1CCc2cc(C#N)ccc2C1 |
| InChI | InChI=1S/C11H11N2/c1-13-5-4-10-6-9(7-12)2-3-11(10)8-13/h2-3,6H,1,4-5,8H2/q-1 |
| InChIKey | LCYDHKCKEXPVID-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|