C18H16N2O2 — CID 133059107
benzyl 6-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 133059107) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is benzyl 6-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl 6-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 133059107 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | benzyl 6-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | N#Cc1ccc2c(c1)CCN(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C18H16N2O2/c19-11-15-6-7-17-12-20(9-8-16(17)10-15)18(21)22-13-14-4-2-1-3-5-14/h1-7,10H,8-9,12-13H2 |
| InChIKey | WXTRZKXNDHUICE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |