C17H21NO2 — CID 101463739
benzyl 3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate (PubChem CID 101463739) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is benzyl 3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl 3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 101463739 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | benzyl 3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC2=C(CCCC2)C1 |
| InChI | InChI=1S/C17H21NO2/c19-17(20-13-14-6-2-1-3-7-14)18-11-10-15-8-4-5-9-16(15)12-18/h1-3,6-7H,4-5,8-13H2 |
| InChIKey | RYGSHKRMAXJIMJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|