C16H16N2O2 — CID 118993560
benzyl 3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate (PubChem CID 118993560) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is benzyl 3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate.
| Compound Name | benzyl 3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 118993560 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | benzyl 3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCc2ccncc2C1 |
| InChI | InChI=1S/C16H16N2O2/c19-16(20-12-13-4-2-1-3-5-13)18-9-7-14-6-8-17-10-15(14)11-18/h1-6,8,10H,7,9,11-12H2 |
| InChIKey | FEMRXKBEGRGLDU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |