C19H19NO3 — CID 133061367
benzyl 6-acetyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 133061367) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is benzyl 6-acetyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl 6-acetyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 133061367 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | benzyl 6-acetyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(=O)c1ccc2c(c1)CCN(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C19H19NO3/c1-14(21)16-7-8-18-12-20(10-9-17(18)11-16)19(22)23-13-15-5-3-2-4-6-15/h2-8,11H,9-10,12-13H2,1H3 |
| InChIKey | REUYHAYMHIWGGQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |