C19H19NO4 — CID 146564812
benzyl 7-formyl-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 146564812) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is benzyl 7-formyl-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl 7-formyl-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 146564812 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | benzyl 7-formyl-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | COc1cc2c(cc1C=O)CN(C(=O)OCc1ccccc1)CC2 |
| InChI | InChI=1S/C19H19NO4/c1-23-18-10-15-7-8-20(11-16(15)9-17(18)12-21)19(22)24-13-14-5-3-2-4-6-14/h2-6,9-10,12H,7-8,11,13H2,1H3 |
| InChIKey | WBZWSNZDQXVSAN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|