C19H19NO4 — CID 171988343
benzyl 8-methoxy-5-oxo-3,4-dihydro-1H-2-benzazepine-2-carboxylate (PubChem CID 171988343) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is benzyl 8-methoxy-5-oxo-3,4-dihydro-1H-2-benzazepine-2-carboxylate.
| Compound Name | benzyl 8-methoxy-5-oxo-3,4-dihydro-1H-2-benzazepine-2-carboxylate |
|---|---|
| PubChem CID | 171988343 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | benzyl 8-methoxy-5-oxo-3,4-dihydro-1H-2-benzazepine-2-carboxylate |
| SMILES | COc1ccc2c(c1)CN(C(=O)OCc1ccccc1)CCC2=O |
| InChI | InChI=1S/C19H19NO4/c1-23-16-7-8-17-15(11-16)12-20(10-9-18(17)21)19(22)24-13-14-5-3-2-4-6-14/h2-8,11H,9-10,12-13H2,1H3 |
| InChIKey | NSRFMIXHZSOHKD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |