C23H26FNO3 — CID 118639806
benzyl 2-(2-fluoro-5-methoxyphenyl)-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 118639806) has the molecular formula C23H26FNO3 and a molecular weight of 383.46 g/mol. Its IUPAC name is benzyl 2-(2-fluoro-5-methoxyphenyl)-7-azaspiro[3.5]nonane-7-carboxylate.
| Compound Name | benzyl 2-(2-fluoro-5-methoxyphenyl)-7-azaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 118639806 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | benzyl 2-(2-fluoro-5-methoxyphenyl)-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | COc1ccc(F)c(C2CC3(CCN(C(=O)OCc4ccccc4)CC3)C2)c1 |
| InChI | InChI=1S/C23H26FNO3/c1-27-19-7-8-21(24)20(13-19)18-14-23(15-18)9-11-25(12-10-23)22(26)28-16-17-5-3-2-4-6-17/h2-8,13,18H,9-12,14-16H2,1H3 |
| InChIKey | XQQXYUBQPYRZCL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |