C18H19NO4 — CID 110756222
phenyl 6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 110756222) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is phenyl 6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | phenyl 6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 110756222 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | phenyl 6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)Oc1ccccc1)CC2 |
| InChI | InChI=1S/C18H19NO4/c1-21-16-10-13-8-9-19(12-14(13)11-17(16)22-2)18(20)23-15-6-4-3-5-7-15/h3-7,10-11H,8-9,12H2,1-2H3 |
| InChIKey | PHVOGHDENIGSBE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |