C20H22N2O4 — CID 108951390
3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-oxo-N-phenylpropanamide (PubChem CID 108951390) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-oxo-N-phenylpropanamide.
| Compound Name | 3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-oxo-N-phenylpropanamide |
|---|---|
| PubChem CID | 108951390 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-oxo-N-phenylpropanamide |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)CC(=O)Nc1ccccc1)CC2 |
| InChI | InChI=1S/C20H22N2O4/c1-25-17-10-14-8-9-22(13-15(14)11-18(17)26-2)20(24)12-19(23)21-16-6-4-3-5-7-16/h3-7,10-11H,8-9,12-13H2,1-2H3,(H,21,23) |
| InChIKey | NGMNNRRMDHIDLQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|