C25H24N2O4 — CID 38447933
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]benzamide (PubChem CID 38447933) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]benzamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 38447933 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]benzamide |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)c1ccc(NC(=O)c3ccccc3)cc1)CC2 |
| InChI | InChI=1S/C25H24N2O4/c1-30-22-14-19-12-13-27(16-20(19)15-23(22)31-2)25(29)18-8-10-21(11-9-18)26-24(28)17-6-4-3-5-7-17/h3-11,14-15H,12-13,16H2,1-2H3,(H,26,28) |
| InChIKey | CACXBYOQIQDRMJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |