C19H20N2O3S — CID 71898676
4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)benzenecarbothioamide (PubChem CID 71898676) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)benzenecarbothioamide.
| Compound Name | 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 71898676 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)benzenecarbothioamide |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)c1ccc(C(N)=S)cc1)CC2 |
| InChI | InChI=1S/C19H20N2O3S/c1-23-16-9-14-7-8-21(11-15(14)10-17(16)24-2)19(22)13-5-3-12(4-6-13)18(20)25/h3-6,9-10H,7-8,11H2,1-2H3,(H2,20,25) |
| InChIKey | KUGMBBKKFLRSFX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|