C25H21NO4 — CID 42093802
2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)fluoren-9-one (PubChem CID 42093802) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)fluoren-9-one.
| Compound Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)fluoren-9-one |
|---|---|
| PubChem CID | 42093802 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)fluoren-9-one |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)c1ccc3c(c1)C(=O)c1ccccc1-3)CC2 |
| InChI | InChI=1S/C25H21NO4/c1-29-22-12-15-9-10-26(14-17(15)13-23(22)30-2)25(28)16-7-8-19-18-5-3-4-6-20(18)24(27)21(19)11-16/h3-8,11-13H,9-10,14H2,1-2H3 |
| InChIKey | WSTCGLNGWAZYHL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |