C19H21N3O4 — CID 26284086
[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]urea (PubChem CID 26284086) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is [3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]urea.
| Compound Name | [3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 26284086 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]urea |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)c1cccc(NC(N)=O)c1)CC2 |
| InChI | InChI=1S/C19H21N3O4/c1-25-16-9-12-6-7-22(11-14(12)10-17(16)26-2)18(23)13-4-3-5-15(8-13)21-19(20)24/h3-5,8-10H,6-7,11H2,1-2H3,(H3,20,21,24) |
| InChIKey | ZIXWVDLOHNTPFI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |