C16H15NO3 — CID 61327924
phenyl 7-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 61327924) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is phenyl 7-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | phenyl 7-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 61327924 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | phenyl 7-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CCc2ccc(O)cc2C1 |
| InChI | InChI=1S/C16H15NO3/c18-14-7-6-12-8-9-17(11-13(12)10-14)16(19)20-15-4-2-1-3-5-15/h1-7,10,18H,8-9,11H2 |
| InChIKey | MNCPFFYKZBSVTO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |