8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid

C11H13NO3 — CID 18536400

IUPAC8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid
SMILESO=C(O)N1CCCc2ccc(O)cc2C1
InChIInChI=1S/C11H13NO3/c13-10-4-3-8-2-1-5-12(11(14)15)7-9(8)6-10/h3-4,6,13H,1-2,5,7H2,(H,14,15)
InChIKeyXDYFZFUKGZJNFZ-UHFFFAOYSA-N
MW207.23 g/mol
LogP1.82
Rot. Bonds

About 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid

8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid (PubChem CID 18536400) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid.

Molecular Properties

Compound Name8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid
PubChem CID18536400
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Name8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid
SMILESO=C(O)N1CCCc2ccc(O)cc2C1
InChIInChI=1S/C11H13NO3/c13-10-4-3-8-2-1-5-12(11(14)15)7-9(8)6-10/h3-4,6,13H,1-2,5,7H2,(H,14,15)
InChIKeyXDYFZFUKGZJNFZ-UHFFFAOYSA-N
XLogP1.82
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 51.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid?
The IUPAC name of 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid (CID 18536400) is 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid.
What is the SMILES notation for 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid?
The canonical SMILES for 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid is O=C(O)N1CCCc2ccc(O)cc2C1.
What is the InChIKey of 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid?
The InChIKey is XDYFZFUKGZJNFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c13-10-4-3-8-2-1-5-12(11(14)15)7-9(8)6-10/h3-4,6,13H,1-2,5,7H2,(H,14,15).
What are the key properties of 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid?
8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid has a molecular weight of 207.23 g/mol, XLogP of 1.82, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid is sourced from PubChem (CID 18536400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).