C17H16N2O4 — CID 171588260
6-amino-2-phenylmethoxycarbonyl-1,3-dihydroisoindole-5-carboxylic acid (PubChem CID 171588260) has the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. Its IUPAC name is 6-amino-2-phenylmethoxycarbonyl-1,3-dihydroisoindole-5-carboxylic acid.
| Compound Name | 6-amino-2-phenylmethoxycarbonyl-1,3-dihydroisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 171588260 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 6-amino-2-phenylmethoxycarbonyl-1,3-dihydroisoindole-5-carboxylic acid |
| SMILES | Nc1cc2c(cc1C(=O)O)CN(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C17H16N2O4/c18-15-7-13-9-19(8-12(13)6-14(15)16(20)21)17(22)23-10-11-4-2-1-3-5-11/h1-7H,8-10,18H2,(H,20,21) |
| InChIKey | YWPFTKZVOVQQIY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|