benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate

C18H19NO2 — CID 170318468

IUPACbenzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate
SMILESCN1CCc2ccc(C(=O)OCc3ccccc3)cc2C1
InChIInChI=1S/C18H19NO2/c1-19-10-9-15-7-8-16(11-17(15)12-19)18(20)21-13-14-5-3-2-4-6-14/h2-8,11H,9-10,12-13H2,1H3
InChIKeyHUHFEPQTXCFZON-UHFFFAOYSA-N
MW281.36 g/mol
LogP3.03
Rot. Bonds3

About benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate

benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate (PubChem CID 170318468) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate.

Molecular Properties

Compound Namebenzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate
PubChem CID170318468
Molecular FormulaC18H19NO2
Molecular Weight281.36 g/mol
Exact Mass281.14
IUPAC Namebenzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate
SMILESCN1CCc2ccc(C(=O)OCc3ccccc3)cc2C1
InChIInChI=1S/C18H19NO2/c1-19-10-9-15-7-8-16(11-17(15)12-19)18(20)21-13-14-5-3-2-4-6-14/h2-8,11H,9-10,12-13H2,1H3
InChIKeyHUHFEPQTXCFZON-UHFFFAOYSA-N
XLogP3.03
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.36
LogP ≤ 53.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate?
The IUPAC name of benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate (CID 170318468) is benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate.
What is the SMILES notation for benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate?
The canonical SMILES for benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate is CN1CCc2ccc(C(=O)OCc3ccccc3)cc2C1.
What is the InChIKey of benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate?
The InChIKey is HUHFEPQTXCFZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2/c1-19-10-9-15-7-8-16(11-17(15)12-19)18(20)21-13-14-5-3-2-4-6-14/h2-8,11H,9-10,12-13H2,1H3.
What are the key properties of benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate?
benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate has a molecular weight of 281.36 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate is sourced from PubChem (CID 170318468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).