C18H19NO2 — CID 170318468
benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate (PubChem CID 170318468) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate.
| Compound Name | benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate |
|---|---|
| PubChem CID | 170318468 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | benzyl 2-methyl-3,4-dihydro-1H-isoquinoline-7-carboxylate |
| SMILES | CN1CCc2ccc(C(=O)OCc3ccccc3)cc2C1 |
| InChI | InChI=1S/C18H19NO2/c1-19-10-9-15-7-8-16(11-17(15)12-19)18(20)21-13-14-5-3-2-4-6-14/h2-8,11H,9-10,12-13H2,1H3 |
| InChIKey | HUHFEPQTXCFZON-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |