C24H22O3 — CID 90254651
benzyl (3S)-3-phenylmethoxy-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 90254651) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is benzyl (3S)-3-phenylmethoxy-2,3-dihydro-1H-indene-5-carboxylate.
| Compound Name | benzyl (3S)-3-phenylmethoxy-2,3-dihydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 90254651 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | benzyl (3S)-3-phenylmethoxy-2,3-dihydro-1H-indene-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1ccc2c(c1)[C@@H](OCc1ccccc1)CC2 |
| InChI | InChI=1S/C24H22O3/c25-24(27-17-19-9-5-2-6-10-19)21-12-11-20-13-14-23(22(20)15-21)26-16-18-7-3-1-4-8-18/h1-12,15,23H,13-14,16-17H2/t23-/m0/s1 |
| InChIKey | PWLMKQPVDKBEMR-QHCPKHFHSA-N |
| XLogP | 5.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |