C16H15BrO — CID 175829642
5-bromo-1-phenylmethoxy-2,3-dihydro-1H-indene (PubChem CID 175829642) has the molecular formula C16H15BrO and a molecular weight of 303.20 g/mol. Its IUPAC name is 5-bromo-1-phenylmethoxy-2,3-dihydro-1H-indene.
| Compound Name | 5-bromo-1-phenylmethoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 175829642 |
| Molecular Formula | C16H15BrO |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 5-bromo-1-phenylmethoxy-2,3-dihydro-1H-indene |
| SMILES | Brc1ccc2c(c1)CCC2OCc1ccccc1 |
| InChI | InChI=1S/C16H15BrO/c17-14-7-8-15-13(10-14)6-9-16(15)18-11-12-4-2-1-3-5-12/h1-5,7-8,10,16H,6,9,11H2 |
| InChIKey | WFBCVIOCOVQGTF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |