C9H10BrN — CID 172734129
5-bromo-1-deuterio-2,3-dihydroinden-1-amine (PubChem CID 172734129) has the molecular formula C9H10BrN and a molecular weight of 213.10 g/mol. Its IUPAC name is 5-bromo-1-deuterio-2,3-dihydroinden-1-amine.
| Compound Name | 5-bromo-1-deuterio-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 172734129 |
| Molecular Formula | C9H10BrN |
| Molecular Weight | 213.10 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 5-bromo-1-deuterio-2,3-dihydroinden-1-amine |
| SMILES | [2H]C1(N)CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C9H10BrN/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5,9H,1,4,11H2/i9D |
| InChIKey | IEUKCNPRRGOGDG-QOWOAITPSA-N |
| XLogP | 2.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.10 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |