C10H12BrN — CID 86326564
(2S)-7-bromo-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 86326564) has the molecular formula C10H12BrN and a molecular weight of 226.12 g/mol. Its IUPAC name is (2S)-7-bromo-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2S)-7-bromo-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 86326564 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | (2S)-7-bromo-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | N[C@H]1CCc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C10H12BrN/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1,3,5,10H,2,4,6,12H2/t10-/m0/s1 |
| InChIKey | PNTPMWBRGXAFII-JTQLQIEISA-N |
| XLogP | 2.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |