C15H21BrN2 — CID 55062243
4-N-(5-bromo-2,3-dihydro-1H-inden-1-yl)cyclohexane-1,4-diamine (PubChem CID 55062243) has the molecular formula C15H21BrN2 and a molecular weight of 309.25 g/mol. Its IUPAC name is 4-N-(5-bromo-2,3-dihydro-1H-inden-1-yl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(5-bromo-2,3-dihydro-1H-inden-1-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 55062243 |
| Molecular Formula | C15H21BrN2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-N-(5-bromo-2,3-dihydro-1H-inden-1-yl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NC2CCc3cc(Br)ccc32)CC1 |
| InChI | InChI=1S/C15H21BrN2/c16-11-2-7-14-10(9-11)1-8-15(14)18-13-5-3-12(17)4-6-13/h2,7,9,12-13,15,18H,1,3-6,8,17H2 |
| InChIKey | JNBLCTIKAPWDEY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |