C13H15BrN2O — CID 106183597
4-[(5-bromo-2,3-dihydro-1H-inden-1-yl)amino]pyrrolidin-2-one (PubChem CID 106183597) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 4-[(5-bromo-2,3-dihydro-1H-inden-1-yl)amino]pyrrolidin-2-one.
| Compound Name | 4-[(5-bromo-2,3-dihydro-1H-inden-1-yl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106183597 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 4-[(5-bromo-2,3-dihydro-1H-inden-1-yl)amino]pyrrolidin-2-one |
| SMILES | O=C1CC(NC2CCc3cc(Br)ccc32)CN1 |
| InChI | InChI=1S/C13H15BrN2O/c14-9-2-3-11-8(5-9)1-4-12(11)16-10-6-13(17)15-7-10/h2-3,5,10,12,16H,1,4,6-7H2,(H,15,17) |
| InChIKey | HGMCTVYSIMYKAX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |