C11H13BrN2O3S — CID 62490790
4-bromo-N-(6-oxopiperidin-3-yl)benzenesulfonamide (PubChem CID 62490790) has the molecular formula C11H13BrN2O3S and a molecular weight of 333.21 g/mol. Its IUPAC name is 4-bromo-N-(6-oxopiperidin-3-yl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(6-oxopiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 62490790 |
| Molecular Formula | C11H13BrN2O3S |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 4-bromo-N-(6-oxopiperidin-3-yl)benzenesulfonamide |
| SMILES | O=C1CCC(NS(=O)(=O)c2ccc(Br)cc2)CN1 |
| InChI | InChI=1S/C11H13BrN2O3S/c12-8-1-4-10(5-2-8)18(16,17)14-9-3-6-11(15)13-7-9/h1-2,4-5,9,14H,3,6-7H2,(H,13,15) |
| InChIKey | LFLBCCFWHHUMCU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |