C10H13N3O3S — CID 63662802
N-(6-oxopiperidin-3-yl)pyridine-3-sulfonamide (PubChem CID 63662802) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is N-(6-oxopiperidin-3-yl)pyridine-3-sulfonamide.
| Compound Name | N-(6-oxopiperidin-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63662802 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-(6-oxopiperidin-3-yl)pyridine-3-sulfonamide |
| SMILES | O=C1CCC(NS(=O)(=O)c2cccnc2)CN1 |
| InChI | InChI=1S/C10H13N3O3S/c14-10-4-3-8(6-12-10)13-17(15,16)9-2-1-5-11-7-9/h1-2,5,7-8,13H,3-4,6H2,(H,12,14) |
| InChIKey | CCCBKYUWNVEXIK-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |