About 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide
3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide (PubChem CID 62491456) has the molecular formula C11H15N3O5S2
and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide.
Molecular Properties
| Compound Name | 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide |
| PubChem CID | 62491456 |
| Molecular Formula | C11H15N3O5S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)NC2CCC(=O)NC2)c1 |
| InChI | InChI=1S/C11H15N3O5S2/c12-20(16,17)9-2-1-3-10(6-9)21(18,19)14-8-4-5-11(15)13-7-8/h1-3,6,8,14H,4-5,7H2,(H,13,15)(H2,12,16,17) |
| InChIKey | AEGYVLVUYYJHLS-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide?
The IUPAC name of 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide (CID 62491456) is 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide.
What is the SMILES notation for 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide?
The canonical SMILES for 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide is NS(=O)(=O)c1cccc(S(=O)(=O)NC2CCC(=O)NC2)c1.
What is the InChIKey of 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide?
The InChIKey is AEGYVLVUYYJHLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O5S2/c12-20(16,17)9-2-1-3-10(6-9)21(18,19)14-8-4-5-11(15)13-7-8/h1-3,6,8,14H,4-5,7H2,(H,13,15)(H2,12,16,17).
What are the key properties of 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide?
3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide has a molecular weight of 333.39 g/mol, XLogP of -1.11, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide is sourced from PubChem (CID 62491456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).