C11H15N3O5S2 — CID 62491456
3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide (PubChem CID 62491456) has the molecular formula C11H15N3O5S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 62491456 |
| Molecular Formula | C11H15N3O5S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 3-N-(6-oxopiperidin-3-yl)benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)NC2CCC(=O)NC2)c1 |
| InChI | InChI=1S/C11H15N3O5S2/c12-20(16,17)9-2-1-3-10(6-9)21(18,19)14-8-4-5-11(15)13-7-8/h1-3,6,8,14H,4-5,7H2,(H,13,15)(H2,12,16,17) |
| InChIKey | AEGYVLVUYYJHLS-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |