C15H17N3O6S3 — CID 18284788
3-N-[3-(cyclopropylsulfamoyl)phenyl]benzene-1,3-disulfonamide (PubChem CID 18284788) has the molecular formula C15H17N3O6S3 and a molecular weight of 431.52 g/mol. Its IUPAC name is 3-N-[3-(cyclopropylsulfamoyl)phenyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[3-(cyclopropylsulfamoyl)phenyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 18284788 |
| Molecular Formula | C15H17N3O6S3 |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 3-N-[3-(cyclopropylsulfamoyl)phenyl]benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)Nc2cccc(S(=O)(=O)NC3CC3)c2)c1 |
| InChI | InChI=1S/C15H17N3O6S3/c16-25(19,20)13-4-2-6-15(10-13)27(23,24)18-12-3-1-5-14(9-12)26(21,22)17-11-7-8-11/h1-6,9-11,17-18H,7-8H2,(H2,16,19,20) |
| InChIKey | GCOULFNVMNCDMW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |