C17H17ClN2O4S2 — CID 71835094
3-[2-(4-chlorophenyl)ethenylsulfonylamino]-N-cyclopropylbenzenesulfonamide (PubChem CID 71835094) has the molecular formula C17H17ClN2O4S2 and a molecular weight of 412.92 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)ethenylsulfonylamino]-N-cyclopropylbenzenesulfonamide.
| Compound Name | 3-[2-(4-chlorophenyl)ethenylsulfonylamino]-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 71835094 |
| Molecular Formula | C17H17ClN2O4S2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 3-[2-(4-chlorophenyl)ethenylsulfonylamino]-N-cyclopropylbenzenesulfonamide |
| SMILES | O=S(=O)(C=Cc1ccc(Cl)cc1)Nc1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C17H17ClN2O4S2/c18-14-6-4-13(5-7-14)10-11-25(21,22)19-16-2-1-3-17(12-16)26(23,24)20-15-8-9-15/h1-7,10-12,15,19-20H,8-9H2 |
| InChIKey | DBLZSTGPOWOVNB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |