C16H17ClN2O4S2 — CID 24629235
2-chloro-N-[3-(cyclopropylsulfamoyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 24629235) has the molecular formula C16H17ClN2O4S2 and a molecular weight of 400.91 g/mol. Its IUPAC name is 2-chloro-N-[3-(cyclopropylsulfamoyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | 2-chloro-N-[3-(cyclopropylsulfamoyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24629235 |
| Molecular Formula | C16H17ClN2O4S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-chloro-N-[3-(cyclopropylsulfamoyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(S(=O)(=O)NC3CC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2O4S2/c1-11-5-8-16(15(17)9-11)25(22,23)19-13-3-2-4-14(10-13)24(20,21)18-12-6-7-12/h2-5,8-10,12,18-19H,6-7H2,1H3 |
| InChIKey | NOAKSXIARCIAME-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |