C19H15ClF2N2O4S2 — CID 24629196
2-chloro-N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-methylbenzenesulfonamide (PubChem CID 24629196) has the molecular formula C19H15ClF2N2O4S2 and a molecular weight of 472.92 g/mol. Its IUPAC name is 2-chloro-N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | 2-chloro-N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24629196 |
| Molecular Formula | C19H15ClF2N2O4S2 |
| Molecular Weight | 472.92 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | 2-chloro-N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NS(=O)(=O)c3ccc(F)c(F)c3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H15ClF2N2O4S2/c1-12-2-9-19(16(20)10-12)30(27,28)24-14-5-3-13(4-6-14)23-29(25,26)15-7-8-17(21)18(22)11-15/h2-11,23-24H,1H3 |
| InChIKey | XPBIYCCMIQNWHD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|