C13H19NO2S — CID 59019434
3-tert-butyl-N-cyclopropylbenzenesulfonamide (PubChem CID 59019434) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 3-tert-butyl-N-cyclopropylbenzenesulfonamide.
| Compound Name | 3-tert-butyl-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 59019434 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-tert-butyl-N-cyclopropylbenzenesulfonamide |
| SMILES | CC(C)(C)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C13H19NO2S/c1-13(2,3)10-5-4-6-12(9-10)17(15,16)14-11-7-8-11/h4-6,9,11,14H,7-8H2,1-3H3 |
| InChIKey | KQHIWAWTULAPCB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |