C14H19NO4S — CID 60808567
4-[(3-methylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid (PubChem CID 60808567) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[(3-methylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3-methylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 60808567 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-[(3-methylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cccc(S(=O)(=O)NC2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C14H19NO4S/c1-10-3-2-4-13(9-10)20(18,19)15-12-7-5-11(6-8-12)14(16)17/h2-4,9,11-12,15H,5-8H2,1H3,(H,16,17) |
| InChIKey | URNYQXAXBPKONX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |