C16H20FNO6S — CID 122101413
4-[[3-fluoro-4-(2-methoxy-2-oxoethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid (PubChem CID 122101413) has the molecular formula C16H20FNO6S and a molecular weight of 373.40 g/mol. Its IUPAC name is 4-[[3-fluoro-4-(2-methoxy-2-oxoethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-fluoro-4-(2-methoxy-2-oxoethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122101413 |
| Molecular Formula | C16H20FNO6S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 4-[[3-fluoro-4-(2-methoxy-2-oxoethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid |
| SMILES | COC(=O)Cc1ccc(S(=O)(=O)NC2CCC(C(=O)O)CC2)cc1F |
| InChI | InChI=1S/C16H20FNO6S/c1-24-15(19)8-11-4-7-13(9-14(11)17)25(22,23)18-12-5-2-10(3-6-12)16(20)21/h4,7,9-10,12,18H,2-3,5-6,8H2,1H3,(H,20,21) |
| InChIKey | HJVIVEKMCDULEM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |