C15H20FNO6S — CID 100814389
methyl 2-[2-fluoro-4-[(4-hydroxycyclohexyl)sulfamoyl]phenoxy]acetate (PubChem CID 100814389) has the molecular formula C15H20FNO6S and a molecular weight of 361.39 g/mol. Its IUPAC name is methyl 2-[2-fluoro-4-[(4-hydroxycyclohexyl)sulfamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-fluoro-4-[(4-hydroxycyclohexyl)sulfamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 100814389 |
| Molecular Formula | C15H20FNO6S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | methyl 2-[2-fluoro-4-[(4-hydroxycyclohexyl)sulfamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)NC2CCC(O)CC2)cc1F |
| InChI | InChI=1S/C15H20FNO6S/c1-22-15(19)9-23-14-7-6-12(8-13(14)16)24(20,21)17-10-2-4-11(18)5-3-10/h6-8,10-11,17-18H,2-5,9H2,1H3 |
| InChIKey | ZSRGTJFGGOGOLY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |