C15H18FNO6S — CID 154805578
2-[4-[[(2S,3R)-2-ethenyloxan-3-yl]sulfamoyl]-2-fluorophenoxy]acetic acid (PubChem CID 154805578) has the molecular formula C15H18FNO6S and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[4-[[(2S,3R)-2-ethenyloxan-3-yl]sulfamoyl]-2-fluorophenoxy]acetic acid.
| Compound Name | 2-[4-[[(2S,3R)-2-ethenyloxan-3-yl]sulfamoyl]-2-fluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 154805578 |
| Molecular Formula | C15H18FNO6S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[4-[[(2S,3R)-2-ethenyloxan-3-yl]sulfamoyl]-2-fluorophenoxy]acetic acid |
| SMILES | C=C[C@@H]1OCCC[C@H]1NS(=O)(=O)c1ccc(OCC(=O)O)c(F)c1 |
| InChI | InChI=1S/C15H18FNO6S/c1-2-13-12(4-3-7-22-13)17-24(20,21)10-5-6-14(11(16)8-10)23-9-15(18)19/h2,5-6,8,12-13,17H,1,3-4,7,9H2,(H,18,19)/t12-,13+/m1/s1 |
| InChIKey | MFNIVEFNIRHKGO-OLZOCXBDSA-N |
| XLogP | 1.30 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|