C17H17F2NO5S2 — CID 57041859
methyl 2-[2-fluoro-4-[2-[(4-fluorophenyl)sulfonylamino]-1-sulfanylethyl]phenoxy]acetate (PubChem CID 57041859) has the molecular formula C17H17F2NO5S2 and a molecular weight of 417.46 g/mol. Its IUPAC name is methyl 2-[2-fluoro-4-[2-[(4-fluorophenyl)sulfonylamino]-1-sulfanylethyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-fluoro-4-[2-[(4-fluorophenyl)sulfonylamino]-1-sulfanylethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 57041859 |
| Molecular Formula | C17H17F2NO5S2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | methyl 2-[2-fluoro-4-[2-[(4-fluorophenyl)sulfonylamino]-1-sulfanylethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(S)CNS(=O)(=O)c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C17H17F2NO5S2/c1-24-17(21)10-25-15-7-2-11(8-14(15)19)16(26)9-20-27(22,23)13-5-3-12(18)4-6-13/h2-8,16,20,26H,9-10H2,1H3 |
| InChIKey | VRSGMBCDEXCTAL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|