C10H12FNO5S — CID 104936683
3-[(4-fluorophenyl)sulfonylamino]-2-methoxypropanoic acid (PubChem CID 104936683) has the molecular formula C10H12FNO5S and a molecular weight of 277.27 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfonylamino]-2-methoxypropanoic acid.
| Compound Name | 3-[(4-fluorophenyl)sulfonylamino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 104936683 |
| Molecular Formula | C10H12FNO5S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfonylamino]-2-methoxypropanoic acid |
| SMILES | COC(CNS(=O)(=O)c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C10H12FNO5S/c1-17-9(10(13)14)6-12-18(15,16)8-4-2-7(11)3-5-8/h2-5,9,12H,6H2,1H3,(H,13,14) |
| InChIKey | FTAPPEZNFMTHJS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |