C10H15FN2O2S — CID 103512475
4-fluoro-N-[2-(methylamino)propyl]benzenesulfonamide (PubChem CID 103512475) has the molecular formula C10H15FN2O2S and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-fluoro-N-[2-(methylamino)propyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-(methylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103512475 |
| Molecular Formula | C10H15FN2O2S |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-fluoro-N-[2-(methylamino)propyl]benzenesulfonamide |
| SMILES | CNC(C)CNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H15FN2O2S/c1-8(12-2)7-13-16(14,15)10-5-3-9(11)4-6-10/h3-6,8,12-13H,7H2,1-2H3 |
| InChIKey | FOZCSLYHFWVHKV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |