C13H21N3O4S2 — CID 120824790
4-N-cyclopropyl-1-N-[2-(methylamino)propyl]benzene-1,4-disulfonamide (PubChem CID 120824790) has the molecular formula C13H21N3O4S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-N-cyclopropyl-1-N-[2-(methylamino)propyl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-cyclopropyl-1-N-[2-(methylamino)propyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 120824790 |
| Molecular Formula | C13H21N3O4S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-N-cyclopropyl-1-N-[2-(methylamino)propyl]benzene-1,4-disulfonamide |
| SMILES | CNC(C)CNS(=O)(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C13H21N3O4S2/c1-10(14-2)9-15-21(17,18)12-5-7-13(8-6-12)22(19,20)16-11-3-4-11/h5-8,10-11,14-16H,3-4,9H2,1-2H3 |
| InChIKey | DEQZJMMREORAIF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |