C13H20N2O3S — CID 83186685
N-cyclopropyl-4-(4-hydroxybutan-2-ylamino)benzenesulfonamide (PubChem CID 83186685) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is N-cyclopropyl-4-(4-hydroxybutan-2-ylamino)benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-(4-hydroxybutan-2-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 83186685 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-cyclopropyl-4-(4-hydroxybutan-2-ylamino)benzenesulfonamide |
| SMILES | CC(CCO)Nc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C13H20N2O3S/c1-10(8-9-16)14-11-4-6-13(7-5-11)19(17,18)15-12-2-3-12/h4-7,10,12,14-16H,2-3,8-9H2,1H3 |
| InChIKey | VCZYYQNJQQRHRO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |