C11H16N2O3S — CID 137403957
4-[(1R)-1-amino-2-hydroxyethyl]-N-cyclopropylbenzenesulfonamide (PubChem CID 137403957) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-[(1R)-1-amino-2-hydroxyethyl]-N-cyclopropylbenzenesulfonamide.
| Compound Name | 4-[(1R)-1-amino-2-hydroxyethyl]-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 137403957 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-[(1R)-1-amino-2-hydroxyethyl]-N-cyclopropylbenzenesulfonamide |
| SMILES | N[C@@H](CO)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C11H16N2O3S/c12-11(7-14)8-1-5-10(6-2-8)17(15,16)13-9-3-4-9/h1-2,5-6,9,11,13-14H,3-4,7,12H2/t11-/m0/s1 |
| InChIKey | APEPDFDBNJXODV-NSHDSACASA-N |
| XLogP | 0.12 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |